kensingtonphil kensingtonphil

07-02-2018
History

contestada

How did the United States acquire the area labeled number 4 on the map?

Respuesta :

tnorris5241 tnorris5241

07-02-2018

Guessing its in the middle of the US. Thats the Louisiana Purchase from France. If it's Alaska, we gained that from the Russian Empire.

Answer Link

Otras preguntas

The function f(x) = (x − 4)(x − 2) is shown.What is the range of the function?

PLEASE HELP!!! Two trains simultaneously left points M and N and headed towards each other. The distance between point M and point N is 380 mi. The speed of the

WHY AVOID HAVANA,CUBA? 5-10 sentences.

simplify the expression using sum or difference identities cos(12)cos(-3)-sin(12)sin(-3)

How does a molecule of water move between the hydrosphere, geosphere, and biosphere

Match the sentence with the correct verb. PLEASE HELP! Miguelina y Guillermo sienten que sus familias ________ muy lejos. Sus familias no dudan que ellos ____

I need help with 15 & 14

Together, Amy and Thea make up 1/2 of the midfielders on the soccer tean. Complete the explanation to determine how many midielders are on the team

Find the constant of proportionality for the graph and write in the form y = kx. A) $15.60 B) $52.00 C) $156.00 D) $556.00

Which is the volume of this cone (use 3.14 for , and round to the nearest hundredth)? A. 20.33 cubic centimeters B. 19.17 cubic centimeters C. 21.33 cubic cent