vargaspriscilla10022 vargaspriscilla10022
  • 10-09-2021
  • Geography
contestada

what 2 internal forces helped the earth the most

Respuesta :

jacole16
jacole16 jacole16
  • 16-09-2021

Answer:

The forces which originate from within the earth's crust or inside the earth are called internal or endogenetic forces. The sources providing them energy are the internal heat, chemical reactions taking place within the earth, and the transfer of rock materials on the earth's surface by external forces.

Explanation:

Answer Link

Otras preguntas

how can the freezing of surface waters make the water that is left unfrozen denser?​
When two events are mutually exclusive, why is P(A and B) 0? Explain.
what form of government does France have today?
simplify the expression using sum or difference identities cos(12)cos(-3)-sin(12)sin(-3)​
Based on the suprimacy Clause, what must a judge support in the event of a legal conflict?
The arc are measures Of circle Z are shown in the figure
why does the woman not suffer from the condition? using a punnet square
What volume (in liters) of gasoline has a total heat of combustion equal to the energy obtained in part (a)? (see section 17.6; the density of gasoline is 900 k
sculpture is in the shape of a cone. The sum of its radius and height is 30 in. Use a graphing calculator to find the radius, to the nearest inch, that gives th
what does kinetic theory describe​